CAS 1512913-90-4 appears in our catalog under these names: 5-Bromo-3-(2,2,2-trifluoroethyl)-3,4-dihydropyrimidin-4-one, 95%, 5-Bromo-3-(2,2,2-trifluoroethyl)-3,4-dihydropyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (CAS 1512913-90-4) is a chemical compound with the molecular formula C6H4BrF3N2O and a molecular weight of 257.01 g/mol. IUPAC name: 5-bromo-3-(2,2,2-trifluoroethyl)pyrimidin-4-one. InChIKey: HVXKIJGRDMURAU-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O |
|---|---|
| Molecular weight | 257.01 g/mol |
| IUPAC name | 5-bromo-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| InChIKey | HVXKIJGRDMURAU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N(C=N1)CC(F)(F)F)Br |
Computed by PubChem (NCBI)