cas: 146447-08-7 — see every product listed under this CAS number, including other names
5-Bromo-2-chloro-4-fluorophenyl methyl carbonate 95+% (CAS 146447-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129298-100mg |
| cas | 146447-08-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1343.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A129298 |
(5-bromo-2-chloro-4-fluorophenyl) methyl carbonate (CAS 146447-08-7) is a chemical compound with the molecular formula C8H5BrClFO3 and a molecular weight of 283.48 g/mol. IUPAC name: (5-bromo-2-chloro-4-fluorophenyl) methyl carbonate. InChIKey: UZBIPTJGVBCMMI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO3 |
|---|---|
| Molecular weight | 283.48 g/mol |
| IUPAC name | (5-bromo-2-chloro-4-fluorophenyl) methyl carbonate |
| InChIKey | UZBIPTJGVBCMMI-UHFFFAOYSA-N |
| SMILES | COC(=O)OC1=CC(=C(C=C1Cl)F)Br |
Computed by PubChem (NCBI)