cas: 146447-08-7 — see every product listed under this CAS number, including other names
5-Bromo-2-chloro-4-fluorophenyl methyl carbonate, 95%, 95% (CAS 146447-08-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXI4-100mg |
| cas | 146447-08-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1106.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(5-bromo-2-chloro-4-fluorophenyl) methyl carbonate (CAS 146447-08-7) is a chemical compound with the molecular formula C8H5BrClFO3 and a molecular weight of 283.48 g/mol. IUPAC name: (5-bromo-2-chloro-4-fluorophenyl) methyl carbonate. InChIKey: UZBIPTJGVBCMMI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO3 |
|---|---|
| Molecular weight | 283.48 g/mol |
| IUPAC name | (5-bromo-2-chloro-4-fluorophenyl) methyl carbonate |
| InChIKey | UZBIPTJGVBCMMI-UHFFFAOYSA-N |
| SMILES | COC(=O)OC1=CC(=C(C=C1Cl)F)Br |
Computed by PubChem (NCBI)