5-Bromo-2-chloronicotinamide, 95%
cas: 75291-85-9 — see every product listed under this CAS number, including other names
5-Bromo-2-chloronicotinamide, 95% (CAS 75291-85-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A438592-250mg |
| cas | 75291-85-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1210.31 Pln | |
| Ambeed | 10g | 2055.81 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 1302.90 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 497.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-2-chloropyridine-3-carboxamide (CAS 75291-85-9) is a chemical compound with the molecular formula C6H4BrClN2O and a molecular weight of 235.46 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3-carboxamide. InChIKey: NFUOTGWWIKJNQL-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3-carboxamide |
| InChIKey | NFUOTGWWIKJNQL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)N)Cl)Br |
Computed by PubChem (NCBI)