CAS 1142192-25-3 is the registry number for 6-Bromo-2-chloronicotinaldehyde oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(NE)-N-[(6-bromo-2-chloro-3-pyridinyl)methylidene]hydroxylamine (CAS 1142192-25-3) is a chemical compound with the molecular formula C6H4BrClN2O and a molecular weight of 235.46 g/mol. IUPAC name: (NE)-N-[(6-bromo-2-chloro-3-pyridinyl)methylidene]hydroxylamine. InChIKey: SQQIXMTXOUWODS-YCRREMRBSA-N.
| Molecular formula | C6H4BrClN2O |
|---|---|
| Molecular weight | 235.46 g/mol |
| IUPAC name | (NE)-N-[(6-bromo-2-chloro-3-pyridinyl)methylidene]hydroxylamine |
| InChIKey | SQQIXMTXOUWODS-YCRREMRBSA-N |
| SMILES | C1=CC(=NC(=C1/C=N/O)Cl)Br |
Computed by PubChem (NCBI)