cas: 1374574-64-7 — see every product listed under this CAS number, including other names
5-Bromo-2-fluoro-4-methoxybenzonitrile, 95%, 95% (CAS 1374574-64-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FTZ4-5g |
| cas | 1374574-64-7 |
| size | 5g |
| availability | 7.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-fluoro-4-methoxybenzonitrile (CAS 1374574-64-7) is a chemical compound with the molecular formula C8H5BrFNO and a molecular weight of 230.03 g/mol. IUPAC name: 5-bromo-2-fluoro-4-methoxybenzonitrile. InChIKey: NLZGBPNUVKGVEZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-methoxybenzonitrile |
| InChIKey | NLZGBPNUVKGVEZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)C#N)Br |
Computed by PubChem (NCBI)