CAS 944805-69-0 appears in our catalog under these names: 5-Bromo-7-fluorooxindole, 98%, 5-Bromo-7-fluoroindolin-2-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
5-bromo-7-fluoro-1,3-dihydroindol-2-one (CAS 944805-69-0) is a chemical compound with the molecular formula C8H5BrFNO and a molecular weight of 230.03 g/mol. IUPAC name: 5-bromo-7-fluoro-1,3-dihydroindol-2-one. InChIKey: WWYUGKFXALMFOC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1,3-dihydroindol-2-one |
| InChIKey | WWYUGKFXALMFOC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Br)F)NC1=O |
Computed by PubChem (NCBI)