cas: 23095-14-9 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxybenzenesulfonamide 96% (CAS 23095-14-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A302978-250mg |
| cas | 23095-14-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1477.31 Pln | |
| Ambeed | 10g | 2534.19 Pln | |
| Ambeed | 25g | 5521.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A302978 |
5-bromo-2-methoxybenzenesulfonamide (CAS 23095-14-9) is a chemical compound with the molecular formula C7H8BrNO3S and a molecular weight of 266.11 g/mol. IUPAC name: 5-bromo-2-methoxybenzenesulfonamide. InChIKey: WHYIIAFUVXCXIL-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO3S |
|---|---|
| Molecular weight | 266.11 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzenesulfonamide |
| InChIKey | WHYIIAFUVXCXIL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)