cas: 23095-14-9 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxybenzenesulfonamide, 95% (CAS 23095-14-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212442-1G |
| cas | 23095-14-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 1471.37 Pln | |
| Fluorochem | 10g | 2533.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-methoxybenzenesulfonamide (CAS 23095-14-9) is a chemical compound with the molecular formula C7H8BrNO3S and a molecular weight of 266.11 g/mol. IUPAC name: 5-bromo-2-methoxybenzenesulfonamide. InChIKey: WHYIIAFUVXCXIL-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO3S |
|---|---|
| Molecular weight | 266.11 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzenesulfonamide |
| InChIKey | WHYIIAFUVXCXIL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)