Products 38275-37-5

CAS 38275-37-5 is the registry number for 5-Bromo-2-methoxy-4-pyrimidinecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-bromo-2-methoxypyrimidine-4-carboxylic acid (CAS 38275-37-5) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 5-bromo-2-methoxypyrimidine-4-carboxylic acid. InChIKey: MEIPPELMHJAIBP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrN2O3
Molecular weight233.02 g/mol
IUPAC name5-bromo-2-methoxypyrimidine-4-carboxylic acid
InChIKeyMEIPPELMHJAIBP-UHFFFAOYSA-N
SMILESCOC1=NC=C(C(=N1)C(=O)O)Br

Computed by PubChem (NCBI)