cas: 1451391-70-0 — see every product listed under this CAS number, including other names
5-Bromo-3-chloro-2-ethoxyphenylboronic acid (CAS 1451391-70-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627854-250MG |
| cas | 1451391-70-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 7401.58 Pln | |
| Fluorochem | 500mg | 8406.43 Pln |
| delivery time | 3-4 weeks |
|---|
(5-bromo-3-chloro-2-ethoxyphenyl)boronic acid (CAS 1451391-70-0) is a chemical compound with the molecular formula C8H9BBrClO3 and a molecular weight of 279.32 g/mol. IUPAC name: (5-bromo-3-chloro-2-ethoxyphenyl)boronic acid. InChIKey: CBQUBIYNGMJEAW-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrClO3 |
|---|---|
| Molecular weight | 279.32 g/mol |
| IUPAC name | (5-bromo-3-chloro-2-ethoxyphenyl)boronic acid |
| InChIKey | CBQUBIYNGMJEAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC)Cl)Br)(O)O |
Computed by PubChem (NCBI)