cas: 1193385-18-0 — see every product listed under this CAS number, including other names
5-Bromo-3-fluoro-2-nitroaniline 95% (CAS 1193385-18-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A297373-100mg |
| cas | 1193385-18-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1499.56 Pln | |
| Ambeed | 5g | 4358.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A297373 |
5-bromo-3-fluoro-2-nitroaniline (CAS 1193385-18-0) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 5-bromo-3-fluoro-2-nitroaniline. InChIKey: PTQHTXBNGYMWER-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 5-bromo-3-fluoro-2-nitroaniline |
| InChIKey | PTQHTXBNGYMWER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)