cas: 1193385-18-0 — see every product listed under this CAS number, including other names
5-Bromo-3-fluoro-2-nitroaniline, 95%, 95% (CAS 1193385-18-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IM5-10g |
| cas | 1193385-18-0 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 5325.20 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1158.80 Pln | |
| Chemat | 5g | 3352.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-3-fluoro-2-nitroaniline (CAS 1193385-18-0) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 5-bromo-3-fluoro-2-nitroaniline. InChIKey: PTQHTXBNGYMWER-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 5-bromo-3-fluoro-2-nitroaniline |
| InChIKey | PTQHTXBNGYMWER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)