cas: 42951-65-5 — see every product listed under this CAS number, including other names
5-Bromo-4,6-dimethyl-1H-pyrazolo[3,4-b]pyridin-3-amine, 97%, 97% (CAS 42951-65-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C6OO-1g |
| cas | 42951-65-5 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4403.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 42951-65-5) is a chemical compound with the molecular formula C8H9BrN4 and a molecular weight of 241.09 g/mol. IUPAC name: 5-bromo-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: RLPPJNGVQYLWPR-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN4 |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 5-bromo-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | RLPPJNGVQYLWPR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NNC(=C12)N)C)Br |
Computed by PubChem (NCBI)