CAS 1256957-80-8 is the registry number for 6-Bromo-n-ethyl-3h-imidazo[4,5-b]pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-N-ethyl-1H-imidazo[4,5-b]pyridin-2-amine (CAS 1256957-80-8) is a chemical compound with the molecular formula C8H9BrN4 and a molecular weight of 241.09 g/mol. IUPAC name: 6-bromo-N-ethyl-1H-imidazo[4,5-b]pyridin-2-amine. InChIKey: GIMQOOGPHZDCPL-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN4 |
|---|---|
| Molecular weight | 241.09 g/mol |
| IUPAC name | 6-bromo-N-ethyl-1H-imidazo[4,5-b]pyridin-2-amine |
| InChIKey | GIMQOOGPHZDCPL-UHFFFAOYSA-N |
| SMILES | CCNC1=NC2=C(N1)C=C(C=N2)Br |
Computed by PubChem (NCBI)