cas: 944401-56-3 — see every product listed under this CAS number, including other names
5-Bromo-4-(trifluoromethyl)pyridin-2-amine 97% (CAS 944401-56-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143318-250mg |
| cas | 944401-56-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 409.31 Pln | |
| Ambeed | 25g | 776.44 Pln | |
| Ambeed | 100g | 2450.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143318 |
5-bromo-4-(trifluoromethyl)pyridin-2-amine (CAS 944401-56-3) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 5-bromo-4-(trifluoromethyl)pyridin-2-amine. InChIKey: AEWYLVDLWQPJGW-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 5-bromo-4-(trifluoromethyl)pyridin-2-amine |
| InChIKey | AEWYLVDLWQPJGW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)Br)C(F)(F)F |
Computed by PubChem (NCBI)