cas: 1211537-20-0 — see every product listed under this CAS number, including other names
5-Bromo-4-chloro-2-(trifluoromethyl)pyridine 96% (CAS 1211537-20-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A275538-100mg |
| cas | 1211537-20-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1171.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A275538 |
5-bromo-4-chloro-2-(trifluoromethyl)pyridine (CAS 1211537-20-0) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 5-bromo-4-chloro-2-(trifluoromethyl)pyridine. InChIKey: SWQDICUZSAFQSM-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-(trifluoromethyl)pyridine |
| InChIKey | SWQDICUZSAFQSM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)