cas: 6943-69-7 — see every product listed under this CAS number, including other names
5-Bromo-4-methoxy-2-nitroaniline, 96% (CAS 6943-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622224-100MG |
| cas | 6943-69-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 2840.68 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-4-methoxy-2-nitroaniline (CAS 6943-69-7) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 5-bromo-4-methoxy-2-nitroaniline. InChIKey: HQUCUBOXGLEYNA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 5-bromo-4-methoxy-2-nitroaniline |
| InChIKey | HQUCUBOXGLEYNA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)