cas: 850375-27-8 — see every product listed under this CAS number, including other names
5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole, 97% (CAS 850375-27-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO00859DA |
| cas | 850375-27-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 276.94 Pln | |
| Thermo Scientific | 10g | 982.52 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS 850375-27-8) is a chemical compound with the molecular formula C11H7BrF3NS and a molecular weight of 322.15 g/mol. IUPAC name: 5-bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole. InChIKey: BZCIYGNYGIKEEC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrF3NS |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | 5-bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| InChIKey | BZCIYGNYGIKEEC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)