CAS 850375-27-8 appears in our catalog under these names: 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole, 95%, 5-Bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g, 10g.
5-bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole (CAS 850375-27-8) is a chemical compound with the molecular formula C11H7BrF3NS and a molecular weight of 322.15 g/mol. IUPAC name: 5-bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole. InChIKey: BZCIYGNYGIKEEC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrF3NS |
|---|---|
| Molecular weight | 322.15 g/mol |
| IUPAC name | 5-bromo-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole |
| InChIKey | BZCIYGNYGIKEEC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)