cas: 1782629-47-3 — see every product listed under this CAS number, including other names
5-Bromo-4-phenylthiazole-2-carbaldehyde, ≥97%, ≥97% (CAS 1782629-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DFBW-100mg |
| cas | 1782629-47-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1806.80 Pln | |
| Chemat | 250mg | 2114.00 Pln | |
| Chemat | 1g | 3789.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4-phenyl-1,3-thiazole-2-carbaldehyde (CAS 1782629-47-3) is a chemical compound with the molecular formula C10H6BrNOS and a molecular weight of 268.13 g/mol. IUPAC name: 5-bromo-4-phenyl-1,3-thiazole-2-carbaldehyde. InChIKey: QQLBTJKFLVUIFH-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNOS |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 5-bromo-4-phenyl-1,3-thiazole-2-carbaldehyde |
| InChIKey | QQLBTJKFLVUIFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C=O)Br |
Computed by PubChem (NCBI)