cas: 1467059-87-5 — see every product listed under this CAS number, including other names
5-Bromo-6-chloro-1H-indole-3-carbaldehyde, 97% (CAS 1467059-87-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A360311-10g |
| cas | 1467059-87-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12152.56 Pln | |
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1112.13 Pln | |
| Fluorochem | 500mg | 1559.89 Pln | |
| Fluorochem | 1g | 2288.80 Pln | |
| Fluorochem | 5g | 6610.19 Pln | |
| Fluorochem | 10g | 11202.32 Pln | |
| Fluorochem | 25g | 23979.07 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-6-chloro-1H-indole-3-carbaldehyde (CAS 1467059-87-5) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 5-bromo-6-chloro-1H-indole-3-carbaldehyde. InChIKey: ISNMSGBNFQGRLG-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 5-bromo-6-chloro-1H-indole-3-carbaldehyde |
| InChIKey | ISNMSGBNFQGRLG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Cl)NC=C2C=O |
Computed by PubChem (NCBI)