cas: 6769-80-8 — see every product listed under this CAS number, including other names
5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt (CAS 6769-80-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047877-250MG |
| cas | 6769-80-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 924.69 Pln |
| delivery time | 2-3 weeks |
|---|
(5-bromo-6-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline (CAS 6769-80-8) is a chemical compound with the molecular formula C15H15BrClN2O4P and a molecular weight of 433.62 g/mol. IUPAC name: (5-bromo-6-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline. InChIKey: WUHVYTJTZAKPOS-UHFFFAOYSA-N.
| Molecular formula | C15H15BrClN2O4P |
|---|---|
| Molecular weight | 433.62 g/mol |
| IUPAC name | (5-bromo-6-chloro-1H-indol-3-yl) dihydrogen phosphate;4-methylaniline |
| InChIKey | WUHVYTJTZAKPOS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N.C1=C2C(=CC(=C1Br)Cl)NC=C2OP(=O)(O)O |
Computed by PubChem (NCBI)