cas: 882500-21-2 — see every product listed under this CAS number, including other names
5-Bromo-6-trifluoromethylpyridin-2-ylamine, 95%, 95% (CAS 882500-21-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N3G-100mg |
| cas | 882500-21-2 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 314.00 Pln | |
| Chemat | 25g | 693.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-6-(trifluoromethyl)pyridin-2-amine (CAS 882500-21-2) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 5-bromo-6-(trifluoromethyl)pyridin-2-amine. InChIKey: DNDAEASRGBLZCN-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 5-bromo-6-(trifluoromethyl)pyridin-2-amine |
| InChIKey | DNDAEASRGBLZCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(F)(F)F)N |
Computed by PubChem (NCBI)