cas: 956003-79-5 — see every product listed under this CAS number, including other names
5-Bromo-8-chloroisoquinoline, 95%, 95% (CAS 956003-79-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ZPF-50mg |
| cas | 956003-79-5 |
| size | 50mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| Chemat | 5g | 7034.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-8-chloroisoquinoline (CAS 956003-79-5) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 5-bromo-8-chloroisoquinoline. InChIKey: RRKXGHIWLJDUIU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 5-bromo-8-chloroisoquinoline |
| InChIKey | RRKXGHIWLJDUIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CN=CC2=C1Cl)Br |
Computed by PubChem (NCBI)