cas: 1290634-39-7 — see every product listed under this CAS number, including other names
5-Bromo-N,2-dimethylbenzamide, 95%, 95% (CAS 1290634-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BB81-100mg |
| cas | 1290634-39-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 1125.20 Pln | |
| Chemat | 1g | 2186.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N,2-dimethylbenzamide (CAS 1290634-39-7) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 5-bromo-N,2-dimethylbenzamide. InChIKey: HQMSFKCYMRDNAE-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 5-bromo-N,2-dimethylbenzamide |
| InChIKey | HQMSFKCYMRDNAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C(=O)NC |
Computed by PubChem (NCBI)