CAS 292170-96-8 appears in our catalog under these names: 5–Bromo–N,N–dimethylnicotinamide, 5-Bromo-N,N-dimethylnicotinamide, 95%, 95%, 5-bromo-N,N-dimethylnicotinamide, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
5-bromo-N,N-dimethylpyridine-3-carboxamide (CAS 292170-96-8) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 5-bromo-N,N-dimethylpyridine-3-carboxamide. InChIKey: NHTSTHBGCFFUMF-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-bromo-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | NHTSTHBGCFFUMF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)