cas: 70232-59-6 — see every product listed under this CAS number, including other names
5-Bromo-N-methyl-3-nitropyridin-2-amine, 98% (CAS 70232-59-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211482-100MG |
| cas | 70232-59-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 539.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-N-methyl-3-nitropyridin-2-amine (CAS 70232-59-6) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-N-methyl-3-nitropyridin-2-amine. InChIKey: KOPIJZGJPUGTHU-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-N-methyl-3-nitropyridin-2-amine |
| InChIKey | KOPIJZGJPUGTHU-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)