Products 1934985-61-1
CAS 1934985-61-1 appears in our catalog under these names: 2,6-Diamino-5-bromo-nicotinic acid, 95%, 2,6-Diamino-5-bromonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2,6-diamino-5-bromopyridine-3-carboxylic acid (CAS 1934985-61-1) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 2,6-diamino-5-bromopyridine-3-carboxylic acid. InChIKey: OSBHKMMKZAZFAS-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2,6-diamino-5-bromopyridine-3-carboxylic acid |
| InChIKey | OSBHKMMKZAZFAS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Br)N)N)C(=O)O |
Computed by PubChem (NCBI)