cas: 173999-19-4 — see every product listed under this CAS number, including other names
5-Bromo-N-methylpyridine-3-sulfonamide, 96% (CAS 173999-19-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A480568-250mg |
| cas | 173999-19-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 486.64 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1528.65 Pln | |
| Fluorochem | 25g | 2580.36 Pln | |
| Fluorochem | 50g | 5110.72 Pln |
| purity | 96% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-N-methylpyridine-3-sulfonamide (CAS 173999-19-4) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: 5-bromo-N-methylpyridine-3-sulfonamide. InChIKey: SNFZSCOGEYEYJG-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 5-bromo-N-methylpyridine-3-sulfonamide |
| InChIKey | SNFZSCOGEYEYJG-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)