cas: 886365-88-4 — see every product listed under this CAS number, including other names
5-Bromo-N-phenylpyrimidin-2-amine, 95%, 95% (CAS 886365-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GS5O-100mg |
| cas | 886365-88-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 500mg | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-N-phenylpyrimidin-2-amine (CAS 886365-88-4) is a chemical compound with the molecular formula C10H8BrN3 and a molecular weight of 250.09 g/mol. IUPAC name: 5-bromo-N-phenylpyrimidin-2-amine. InChIKey: GQNKPOBYNQYDOB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3 |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | 5-bromo-N-phenylpyrimidin-2-amine |
| InChIKey | GQNKPOBYNQYDOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)