CAS 344940-70-1 appears in our catalog under these names: 5-Bromo-3-phenylpyrazin-2-amine, 95%, 5–Bromo–3–phenylpyrazin–2–amine, 5-Bromo-3-phenylpyrazin-2-amine 95%, 5-Bromo-3-phenylpyrazin-2-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
5-bromo-3-phenylpyrazin-2-amine (CAS 344940-70-1) is a chemical compound with the molecular formula C10H8BrN3 and a molecular weight of 250.09 g/mol. IUPAC name: 5-bromo-3-phenylpyrazin-2-amine. InChIKey: UZSHZSKPUZBMRE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3 |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | 5-bromo-3-phenylpyrazin-2-amine |
| InChIKey | UZSHZSKPUZBMRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CN=C2N)Br |
Computed by PubChem (NCBI)