Products 1253654-73-7
CAS 1253654-73-7 appears in our catalog under these names: 5-Bromoisoquinoline-1-carboxylic acid, 5-Bromoisoquinoline-1-carboxylic acid, 95%, 95%, 5-Bromoisoquinoline-1-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 2,5g, 50mg, 100mg, 1g.
5-bromoisoquinoline-1-carboxylic acid (CAS 1253654-73-7) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 5-bromoisoquinoline-1-carboxylic acid. InChIKey: AFXXNDCVWRDKAK-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 5-bromoisoquinoline-1-carboxylic acid |
| InChIKey | AFXXNDCVWRDKAK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=O)O)C(=C1)Br |
Computed by PubChem (NCBI)