CAS 21724-96-9 appears in our catalog under these names: 3-(4-Bromophenyl)-2,5-dihydro-1h-pyrrole-2,5-dione, 95%, 3–(4–Bromophenyl)–1H–pyrrole–2,5–dione, 3-(4-bromophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
3-(4-bromophenyl)pyrrole-2,5-dione (CAS 21724-96-9) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 3-(4-bromophenyl)pyrrole-2,5-dione. InChIKey: YDIFCLVEBRJPOA-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 3-(4-bromophenyl)pyrrole-2,5-dione |
| InChIKey | YDIFCLVEBRJPOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)NC2=O)Br |
Computed by PubChem (NCBI)