cas: 62009-34-1 — see every product listed under this CAS number, including other names
5-Bromopyridine-3-sulfonic acid, 95%, 95% (CAS 62009-34-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBMX-250mg |
| cas | 62009-34-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1715.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromopyridine-3-sulfonic acid (CAS 62009-34-1) is a chemical compound with the molecular formula C5H4BrNO3S and a molecular weight of 238.06 g/mol. IUPAC name: 5-bromopyridine-3-sulfonic acid. InChIKey: SMLXJWRGAHUNNM-UHFFFAOYSA-N.
| Molecular formula | C5H4BrNO3S |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 5-bromopyridine-3-sulfonic acid |
| InChIKey | SMLXJWRGAHUNNM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)S(=O)(=O)O |
Computed by PubChem (NCBI)