CAS 62009-34-1 appears in our catalog under these names: 5-Bromopyridine-3-sulfonic acid, 95%, 5-Bromopyridine-3-sulfonic acid, 95%, 95%, 5-Bromopyridine-3-sulfonic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg, 100mg.
5-bromopyridine-3-sulfonic acid (CAS 62009-34-1) is a chemical compound with the molecular formula C5H4BrNO3S and a molecular weight of 238.06 g/mol. IUPAC name: 5-bromopyridine-3-sulfonic acid. InChIKey: SMLXJWRGAHUNNM-UHFFFAOYSA-N.
| Molecular formula | C5H4BrNO3S |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 5-bromopyridine-3-sulfonic acid |
| InChIKey | SMLXJWRGAHUNNM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)S(=O)(=O)O |
Computed by PubChem (NCBI)