CAS 1378448-42-0 appears in our catalog under these names: 5-Bromothieno(3,2-b)thiophene-2-carboxylic acid, 5-Bromothieno[3,2-b]thiophene-2-carboxylic acid, 95%, 95%, 5-Bromothieno[3,2-b]thiophene-2-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 250mg, 25mg, 50mg, 100mg, 1g, 5g.
5-bromothieno[3,2-b]thiophene-2-carboxylic acid (CAS 1378448-42-0) is a chemical compound with the molecular formula C7H3BrO2S2 and a molecular weight of 263.1 g/mol. IUPAC name: 5-bromothieno[3,2-b]thiophene-2-carboxylic acid. InChIKey: PMZFZHLHTDFWBI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrO2S2 |
|---|---|
| Molecular weight | 263.1 g/mol |
| IUPAC name | 5-bromothieno[3,2-b]thiophene-2-carboxylic acid |
| InChIKey | PMZFZHLHTDFWBI-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)