CAS 125493-06-3 appears in our catalog under these names: 6-Bromothieno[3,2-b]thiophene-2-carboxylic acid, 95%, 6-bromothieno(3,2-b)thiophene-2-carboxylic acid, 6-Bromothieno[3,2-b]thiophene-2-carboxylic Acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 0,5g, 100mg.
3-bromothieno[3,2-b]thiophene-5-carboxylic acid (CAS 125493-06-3) is a chemical compound with the molecular formula C7H3BrO2S2 and a molecular weight of 263.1 g/mol. IUPAC name: 3-bromothieno[3,2-b]thiophene-5-carboxylic acid. InChIKey: RLUHYSKWVZFEOE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrO2S2 |
|---|---|
| Molecular weight | 263.1 g/mol |
| IUPAC name | 3-bromothieno[3,2-b]thiophene-5-carboxylic acid |
| InChIKey | RLUHYSKWVZFEOE-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC=C2Br)C(=O)O |
Computed by PubChem (NCBI)