cas: 1454653-85-0 — see every product listed under this CAS number, including other names
5-Chloro[1,2,4]triazolo[1,5-a]pyrazin-2-amine, 95% (CAS 1454653-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601966-100MG |
| cas | 1454653-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 3267.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (CAS 1454653-85-0) is a chemical compound with the molecular formula C5H4ClN5 and a molecular weight of 169.57 g/mol. IUPAC name: 5-chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine. InChIKey: XWZGFYCINZXWMN-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN5 |
|---|---|
| Molecular weight | 169.57 g/mol |
| IUPAC name | 5-chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| InChIKey | XWZGFYCINZXWMN-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=NC(=N2)N)C=N1)Cl |
Computed by PubChem (NCBI)