Products 1454653-85-0
CAS 1454653-85-0 appears in our catalog under these names: 5-Chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-ylamine, 95%, 5-Chloro(1,2,4)triazolo(1,5-a)pyrazin-2-amine, 5-Chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine, 95%, 95%, 5-Chloro[1,2,4]triazolo[1,5-a]pyrazin-2-amine, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,5g, 100mg.
5-chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (CAS 1454653-85-0) is a chemical compound with the molecular formula C5H4ClN5 and a molecular weight of 169.57 g/mol. IUPAC name: 5-chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine. InChIKey: XWZGFYCINZXWMN-UHFFFAOYSA-N.
| Molecular formula | C5H4ClN5 |
|---|---|
| Molecular weight | 169.57 g/mol |
| IUPAC name | 5-chloro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| InChIKey | XWZGFYCINZXWMN-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=NC(=N2)N)C=N1)Cl |
Computed by PubChem (NCBI)