cas: 249636-63-3 — see every product listed under this CAS number, including other names
5-Chloro-1,3-benzodioxole-4-carboxaldehyde, 98% (CAS 249636-63-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F983335-100MG |
| cas | 249636-63-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 534.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-1,3-benzodioxole-4-carbaldehyde (CAS 249636-63-3) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 5-chloro-1,3-benzodioxole-4-carbaldehyde. InChIKey: ROFXYEJXCPDMJT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 5-chloro-1,3-benzodioxole-4-carbaldehyde |
| InChIKey | ROFXYEJXCPDMJT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)