Products 58588-59-3
CAS 58588-59-3 appears in our catalog under these names: 3-chloro-4-formylbenzoic acid, 3-Chloro-4-formylbenzoic acid, 95%, 3-Chloro-4-formylbenzoic acid 98%, 3-CHLORO-4-FORMYLBENZOIC ACID, 98%, 3-Chloro-4-formylbenzoic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
3-chloro-4-formylbenzoic acid (CAS 58588-59-3) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 3-chloro-4-formylbenzoic acid. InChIKey: STTXUSSNIZOQGV-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 3-chloro-4-formylbenzoic acid |
| InChIKey | STTXUSSNIZOQGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C=O |
Computed by PubChem (NCBI)