cas: 1210-33-9 — see every product listed under this CAS number, including other names
5-Chloro-10,11-dihydro-5H-dibenzo[a,d][7]annulene, 98% (CAS 1210-33-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602166-10G |
| cas | 1210-33-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 643.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (CAS 1210-33-9) is a chemical compound with the molecular formula C15H13Cl and a molecular weight of 228.71 g/mol. IUPAC name: 2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene. InChIKey: QPERNSDCEUTOTE-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl |
|---|---|
| Molecular weight | 228.71 g/mol |
| IUPAC name | 2-chlorotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| InChIKey | QPERNSDCEUTOTE-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)Cl |
Computed by PubChem (NCBI)