CAS 150253-59-1 appears in our catalog under these names: Benzene, 1-(chloromethyl)-4-[(1E)-2-phenylethenyl]-, 98%, 4-Chloromethylstilbene, 95%, 4-((E)-Phenylethenyl))benzyl chloride, 98%, 4–((E)–Phenylethenyl))benzyl chloride, 4-Chloromethylstilbene, 98%, 98%. Offered by: Fluorochem, Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
1-(chloromethyl)-4-[(E)-2-phenylethenyl]benzene (CAS 150253-59-1) is a chemical compound with the molecular formula C15H13Cl and a molecular weight of 228.71 g/mol. IUPAC name: 1-(chloromethyl)-4-[(E)-2-phenylethenyl]benzene. InChIKey: IWJQBYQAGGHNAB-VOTSOKGWSA-N.
| Molecular formula | C15H13Cl |
|---|---|
| Molecular weight | 228.71 g/mol |
| IUPAC name | 1-(chloromethyl)-4-[(E)-2-phenylethenyl]benzene |
| InChIKey | IWJQBYQAGGHNAB-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)