cas: 1630906-47-6 — see every product listed under this CAS number, including other names
5-Chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile, 97%, 97% (CAS 1630906-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQS8-100mg |
| cas | 1630906-47-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1317.20 Pln | |
| Chemat | 250mg | 2147.60 Pln | |
| Chemat | 500mg | 3544.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile (CAS 1630906-47-6) is a chemical compound with the molecular formula C8H4ClN3 and a molecular weight of 177.59 g/mol. IUPAC name: 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile. InChIKey: CYULQIWXOBZJIP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3 |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | 5-chloro-1H-pyrrolo[3,2-b]pyridine-2-carbonitrile |
| InChIKey | CYULQIWXOBZJIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC(=C2)C#N)Cl |
Computed by PubChem (NCBI)