cas: 1160260-10-5 — see every product listed under this CAS number, including other names
5-Chloro-2-((4-fluorobenzyl)oxy)benzoyl chloride, 97% (CAS 1160260-10-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A623856-5g |
| cas | 1160260-10-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8533.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-2-[(4-fluorophenyl)methoxy]benzoyl chloride (CAS 1160260-10-5) is a chemical compound with the molecular formula C14H9Cl2FO2 and a molecular weight of 299.1 g/mol. IUPAC name: 5-chloro-2-[(4-fluorophenyl)methoxy]benzoyl chloride. InChIKey: AGXAJOHSPMEURE-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2FO2 |
|---|---|
| Molecular weight | 299.1 g/mol |
| IUPAC name | 5-chloro-2-[(4-fluorophenyl)methoxy]benzoyl chloride |
| InChIKey | AGXAJOHSPMEURE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C=C(C=C2)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)