Products 1361753-08-3
CAS 1361753-08-3 is the registry number for methyl 4-(3,5-dichlorophenyl)-2-fluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(3,5-dichlorophenyl)-2-fluorobenzoate (CAS 1361753-08-3) is a chemical compound with the molecular formula C14H9Cl2FO2 and a molecular weight of 299.1 g/mol. IUPAC name: methyl 4-(3,5-dichlorophenyl)-2-fluorobenzoate. InChIKey: QQORJPOYBOOWGJ-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2FO2 |
|---|---|
| Molecular weight | 299.1 g/mol |
| IUPAC name | methyl 4-(3,5-dichlorophenyl)-2-fluorobenzoate |
| InChIKey | QQORJPOYBOOWGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=CC(=C2)Cl)Cl)F |
Computed by PubChem (NCBI)