cas: 957062-64-5 — see every product listed under this CAS number, including other names
5-Chloro-2-(methoxycarbonyl)phenylboronic acid, 98%, 98% (CAS 957062-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H94Q-250mg |
| cas | 957062-64-5 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(5-chloro-2-methoxycarbonylphenyl)boronic acid (CAS 957062-64-5) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (5-chloro-2-methoxycarbonylphenyl)boronic acid. InChIKey: JHPMDNPILTXCFY-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (5-chloro-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | JHPMDNPILTXCFY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C(=O)OC)(O)O |
Computed by PubChem (NCBI)