CAS 874219-45-1 appears in our catalog under these names: 4-Chloro-3-(methoxycarbonyl)phenylboronic acid, 98%, (4-Chloro-3-(methoxycarbonyl)phenyl)boronic acid, 4-Chloro-3-(methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), >97.0%(T), 4-Chloro-3-(methoxycarbonyl)phenylboronic acid, 97%. Offered by: Combi-blocks, Biosynth, TCI, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 200mg.
(4-chloro-3-methoxycarbonylphenyl)boronic acid (CAS 874219-45-1) is a chemical compound with the molecular formula C8H8BClO4 and a molecular weight of 214.41 g/mol. IUPAC name: (4-chloro-3-methoxycarbonylphenyl)boronic acid. InChIKey: YEPWHDGFBVDINZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO4 |
|---|---|
| Molecular weight | 214.41 g/mol |
| IUPAC name | (4-chloro-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | YEPWHDGFBVDINZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)OC)(O)O |
Computed by PubChem (NCBI)