cas: 117449-75-9 — see every product listed under this CAS number, including other names
5-Chloro-2-hydroxy-6-methylnicotinic acid, 97%, 97% (CAS 117449-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111EC1-100mg |
| cas | 117449-75-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 1998.80 Pln | |
| Chemat | 10g | 3933.20 Pln | |
| Chemat | 25g | 9645.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 117449-75-9) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: HHWSFTFWHAQORS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | HHWSFTFWHAQORS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C(=O)O)Cl |
Computed by PubChem (NCBI)